C36H42N8O5 — CID 121327041
2-butan-2-yl-4-[4-[4-[4-[[2-(2-methoxyphenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 121327041) has the molecular formula C36H42N8O5 and a molecular weight of 666.78 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[2-(2-methoxyphenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[2-(2-methoxyphenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121327041 |
| Molecular Formula | C36H42N8O5 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[2-(2-methoxyphenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6nccn6)(c6ccccc6OC)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C36H42N8O5/c1-4-27(2)44-35(45)42(26-39-44)30-11-9-28(10-12-30)40-19-21-41(22-20-40)29-13-15-31(16-14-29)47-23-32-24-48-36(49-32,25-43-37-17-18-38-43)33-7-5-6-8-34(33)46-3/h5-18,26-27,32H,4,19-25H2,1-3H3 |
| InChIKey | UMYLSIIOACTEOH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|