C37H41N7O5 — CID 145098542
2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2-hydroxyphenyl)-2-(pyridazin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 145098542) has the molecular formula C37H41N7O5 and a molecular weight of 663.78 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2-hydroxyphenyl)-2-(pyridazin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2-hydroxyphenyl)-2-(pyridazin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 145098542 |
| Molecular Formula | C37H41N7O5 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.32 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2-hydroxyphenyl)-2-(pyridazin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@](Cc6ccnnc6)(c6ccccc6O)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C37H41N7O5/c1-3-27(2)44-36(46)43(26-40-44)31-10-8-29(9-11-31)41-18-20-42(21-19-41)30-12-14-32(15-13-30)47-24-33-25-48-37(49-33,22-28-16-17-38-39-23-28)34-6-4-5-7-35(34)45/h4-17,23,26-27,33,45H,3,18-22,24-25H2,1-2H3/t27?,33-,37+/m1/s1 |
| InChIKey | QSMUYOAPFSLBJS-JSFLCRQBSA-N |
| XLogP | 4.72 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|