C40H48ClN6O4P — CID 144755062
2-butan-2-yl-4-[4-[4-[4-[[2-(2-chloro-4-phosphanylphenyl)-2-(pyridin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;ethane (PubChem CID 144755062) has the molecular formula C40H48ClN6O4P and a molecular weight of 743.29 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[2-(2-chloro-4-phosphanylphenyl)-2-(pyridin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;ethane.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[2-(2-chloro-4-phosphanylphenyl)-2-(pyridin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;ethane |
|---|---|
| PubChem CID | 144755062 |
| Molecular Formula | C40H48ClN6O4P |
| Molecular Weight | 743.29 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[2-(2-chloro-4-phosphanylphenyl)-2-(pyridin-4-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;ethane |
| SMILES | CC.CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cc6ccncc6)(c6ccc(P)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C38H42ClN6O4P.C2H6/c1-3-27(2)45-37(46)44(26-41-45)31-6-4-29(5-7-31)42-18-20-43(21-19-42)30-8-10-32(11-9-30)47-24-33-25-48-38(49-33,23-28-14-16-40-17-15-28)35-13-12-34(50)22-36(35)39;1-2/h4-17,22,26-27,33H,3,18-21,23-25,50H2,1-2H3;1-2H3 |
| InChIKey | ORDOKZQQNGCVHQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 86.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.29 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|