C35H42N8O4 — CID 163433740
2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-cyclohexa-1,5-dien-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 163433740) has the molecular formula C35H42N8O4 and a molecular weight of 638.77 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-cyclohexa-1,5-dien-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-cyclohexa-1,5-dien-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 163433740 |
| Molecular Formula | C35H42N8O4 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-cyclohexa-1,5-dien-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6nccn6)(C6=CCCC=C6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C35H42N8O4/c1-3-27(2)43-34(44)41(26-38-43)31-11-9-29(10-12-31)39-19-21-40(22-20-39)30-13-15-32(16-14-30)45-23-33-24-46-35(47-33,25-42-36-17-18-37-42)28-7-5-4-6-8-28/h5,7-18,26-27,33H,3-4,6,19-25H2,1-2H3/t27?,33-,35-/m1/s1 |
| InChIKey | ASRNLNKRWLOURE-ZZXAUAAYSA-N |
| XLogP | 4.39 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|