C37H38IN9O4 — CID 163932256
2-(1-iodopropyl)-4-[4-[4-[4-[[2-isoquinolin-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 163932256) has the molecular formula C37H38IN9O4 and a molecular weight of 799.67 g/mol. Its IUPAC name is 2-(1-iodopropyl)-4-[4-[4-[4-[[2-isoquinolin-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-(1-iodopropyl)-4-[4-[4-[4-[[2-isoquinolin-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 163932256 |
| Molecular Formula | C37H38IN9O4 |
| Molecular Weight | 799.67 g/mol |
| Exact Mass | 799.21 |
| IUPAC Name | 2-(1-iodopropyl)-4-[4-[4-[4-[[2-isoquinolin-1-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(I)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6nccn6)(c6nccc7ccccc67)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C37H38IN9O4/c1-2-34(38)47-36(48)45(26-42-47)30-9-7-28(8-10-30)43-19-21-44(22-20-43)29-11-13-31(14-12-29)49-23-32-24-50-37(51-32,25-46-40-17-18-41-46)35-33-6-4-3-5-27(33)15-16-39-35/h3-18,26,32,34H,2,19-25H2,1H3 |
| InChIKey | RJRHNQMAKLZLAJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|