C36H49N9O5 — CID 144755147
4-[4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]piperidin-2-one;ethane (PubChem CID 144755147) has the molecular formula C36H49N9O5 and a molecular weight of 687.85 g/mol. Its IUPAC name is 4-[4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]piperidin-2-one;ethane.
| Compound Name | 4-[4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]piperidin-2-one;ethane |
|---|---|
| PubChem CID | 144755147 |
| Molecular Formula | C36H49N9O5 |
| Molecular Weight | 687.85 g/mol |
| Exact Mass | 687.39 |
| IUPAC Name | 4-[4-[[4-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]phenoxy]methyl]-2-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]piperidin-2-one;ethane |
| SMILES | CC.CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6nccn6)(C6CCNC(=O)C6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C34H43N9O5.C2H6/c1-3-25(2)43-33(45)41(24-38-43)29-6-4-27(5-7-29)39-16-18-40(19-17-39)28-8-10-30(11-9-28)46-21-31-22-47-34(48-31,23-42-36-14-15-37-42)26-12-13-35-32(44)20-26;1-2/h4-11,14-15,24-26,31H,3,12-13,16-23H2,1-2H3,(H,35,44);1-2H3 |
| InChIKey | SFTINCMFMFXQQW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|