C36H42N8O3 — CID 121405022
2-[(2S)-butan-2-yl]-4-[4-[4-[4-[[(3R,5R)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 121405022) has the molecular formula C36H42N8O3 and a molecular weight of 634.79 g/mol. Its IUPAC name is 2-[(2S)-butan-2-yl]-4-[4-[4-[4-[[(3R,5R)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(2S)-butan-2-yl]-4-[4-[4-[4-[[(3R,5R)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121405022 |
| Molecular Formula | C36H42N8O3 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | 2-[(2S)-butan-2-yl]-4-[4-[4-[4-[[(3R,5R)-5-phenyl-5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CC[C@H](C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6nccn6)(c6ccccc6)C5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C36H42N8O3/c1-3-28(2)44-35(45)42(27-39-44)33-11-9-31(10-12-33)40-19-21-41(22-20-40)32-13-15-34(16-14-32)46-24-29-23-36(47-25-29,26-43-37-17-18-38-43)30-7-5-4-6-8-30/h4-18,27-29H,3,19-26H2,1-2H3/t28-,29+,36-/m0/s1 |
| InChIKey | JGNIXQPWDWSYLS-WEPHICOPSA-N |
| XLogP | 4.93 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|