C36H44N8O4 — CID 145098571
4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-pentan-3-yl-1,2,4-triazol-3-one;2-[(2-phenyl-1,3-dioxolan-2-yl)methyl]triazole (PubChem CID 145098571) has the molecular formula C36H44N8O4 and a molecular weight of 652.80 g/mol. Its IUPAC name is 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-pentan-3-yl-1,2,4-triazol-3-one;2-[(2-phenyl-1,3-dioxolan-2-yl)methyl]triazole.
| Compound Name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-pentan-3-yl-1,2,4-triazol-3-one;2-[(2-phenyl-1,3-dioxolan-2-yl)methyl]triazole |
|---|---|
| PubChem CID | 145098571 |
| Molecular Formula | C36H44N8O4 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-pentan-3-yl-1,2,4-triazol-3-one;2-[(2-phenyl-1,3-dioxolan-2-yl)methyl]triazole |
| SMILES | CCC(CC)n1ncn(-c2ccc(N3CCN(c4ccc(OC)cc4)CC3)cc2)c1=O.c1ccc(C2(Cn3nccn3)OCCO2)cc1 |
| InChI | InChI=1S/C24H31N5O2.C12H13N3O2/c1-4-19(5-2)29-24(30)28(18-25-29)22-8-6-20(7-9-22)26-14-16-27(17-15-26)21-10-12-23(31-3)13-11-21;1-2-4-11(5-3-1)12(16-8-9-17-12)10-15-13-6-7-14-15/h6-13,18-19H,4-5,14-17H2,1-3H3;1-7H,8-10H2 |
| InChIKey | MDKBEBMELZAOMI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|