C23H28N8O2 — CID 142647831
2-(3-azidobutan-2-yl)-4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 142647831) has the molecular formula C23H28N8O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-(3-azidobutan-2-yl)-4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-(3-azidobutan-2-yl)-4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 142647831 |
| Molecular Formula | C23H28N8O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-(3-azidobutan-2-yl)-4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4cnn(C(C)C(C)N=[N+]=[N-])c4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N8O2/c1-17(26-27-24)18(2)31-23(32)30(16-25-31)21-6-4-19(5-7-21)28-12-14-29(15-13-28)20-8-10-22(33-3)11-9-20/h4-11,16-18H,12-15H2,1-3H3 |
| InChIKey | PUYCSCUFSIUUNA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|