C23H27N5O4 — CID 18510491
methyl 2-[4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butanoate (PubChem CID 18510491) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is methyl 2-[4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butanoate.
| Compound Name | methyl 2-[4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butanoate |
|---|---|
| PubChem CID | 18510491 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | methyl 2-[4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butanoate |
| SMILES | CCC(C(=O)OC)n1ncn(-c2ccc(N3CCN(c4ccc(O)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C23H27N5O4/c1-3-21(22(30)32-2)28-23(31)27(16-24-28)19-6-4-17(5-7-19)25-12-14-26(15-13-25)18-8-10-20(29)11-9-18/h4-11,16,21,29H,3,12-15H2,1-2H3 |
| InChIKey | WFQJGEZWIZAVIV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|