C34H48N6O3 — CID 143249503
ethane;4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-[(2R,3R)-3-(2-phenoxyethylamino)butan-2-yl]-1,2,4-triazol-3-one (PubChem CID 143249503) has the molecular formula C34H48N6O3 and a molecular weight of 588.80 g/mol. Its IUPAC name is ethane;4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-[(2R,3R)-3-(2-phenoxyethylamino)butan-2-yl]-1,2,4-triazol-3-one.
| Compound Name | ethane;4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-[(2R,3R)-3-(2-phenoxyethylamino)butan-2-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 143249503 |
| Molecular Formula | C34H48N6O3 |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | ethane;4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-2-[(2R,3R)-3-(2-phenoxyethylamino)butan-2-yl]-1,2,4-triazol-3-one |
| SMILES | CC.CC.C[C@H]([C@@H](C)NCCOc1ccccc1)n1ncn(-c2ccc(N3CCN(c4ccc(O)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C30H36N6O3.2C2H6/c1-23(31-16-21-39-29-6-4-3-5-7-29)24(2)36-30(38)35(22-32-36)27-10-8-25(9-11-27)33-17-19-34(20-18-33)26-12-14-28(37)15-13-26;2*1-2/h3-15,22-24,31,37H,16-21H2,1-2H3;2*1-2H3/t23-,24-;;/m1../s1 |
| InChIKey | MODKYVPGKXRPNM-NILKIKDOSA-N |
| XLogP | 5.74 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|