C26H33N5O2 — CID 59515572
4-[4-[4-(3-methyl-2-oxo-1-phenylbutyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one (PubChem CID 59515572) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-[4-[4-(3-methyl-2-oxo-1-phenylbutyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-(3-methyl-2-oxo-1-phenylbutyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 59515572 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 4-[4-[4-(3-methyl-2-oxo-1-phenylbutyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
| SMILES | CC(C)C(=O)C(c1ccccc1)N1CCN(c2ccc(-n3cnn(C(C)C)c3=O)cc2)CC1 |
| InChI | InChI=1S/C26H33N5O2/c1-19(2)25(32)24(21-8-6-5-7-9-21)29-16-14-28(15-17-29)22-10-12-23(13-11-22)30-18-27-31(20(3)4)26(30)33/h5-13,18-20,24H,14-17H2,1-4H3 |
| InChIKey | CRTWRASRVISHJZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|