C34H41N5O2 — CID 59140058
4-[4-[4-(5-methyl-4-oxo-3,3-diphenylhexyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one (PubChem CID 59140058) has the molecular formula C34H41N5O2 and a molecular weight of 551.74 g/mol. Its IUPAC name is 4-[4-[4-(5-methyl-4-oxo-3,3-diphenylhexyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-(5-methyl-4-oxo-3,3-diphenylhexyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 59140058 |
| Molecular Formula | C34H41N5O2 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | 4-[4-[4-(5-methyl-4-oxo-3,3-diphenylhexyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
| SMILES | CC(C)C(=O)C(CCN1CCN(c2ccc(-n3cnn(C(C)C)c3=O)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H41N5O2/c1-26(2)32(40)34(28-11-7-5-8-12-28,29-13-9-6-10-14-29)19-20-36-21-23-37(24-22-36)30-15-17-31(18-16-30)38-25-35-39(27(3)4)33(38)41/h5-18,25-27H,19-24H2,1-4H3 |
| InChIKey | TWPSYQAKOGPFGU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|