C30H32FN5O3 — CID 71173015
ethyl (2S)-2-[4-[4-[1-[(1R)-1-(2-fluorophenyl)ethyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 71173015) has the molecular formula C30H32FN5O3 and a molecular weight of 529.62 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[4-[1-[(1R)-1-(2-fluorophenyl)ethyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[4-[4-[1-[(1R)-1-(2-fluorophenyl)ethyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 71173015 |
| Molecular Formula | C30H32FN5O3 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | ethyl (2S)-2-[4-[4-[1-[(1R)-1-(2-fluorophenyl)ethyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | CCOC(=O)[C@H](c1ccccc1)N1CCN(c2ccc(-n3cnn([C@H](C)c4ccccc4F)c3=O)cc2)CC1 |
| InChI | InChI=1S/C30H32FN5O3/c1-3-39-29(37)28(23-9-5-4-6-10-23)34-19-17-33(18-20-34)24-13-15-25(16-14-24)35-21-32-36(30(35)38)22(2)26-11-7-8-12-27(26)31/h4-16,21-22,28H,3,17-20H2,1-2H3/t22-,28+/m1/s1 |
| InChIKey | ZVLHVKXRPRMURV-DFHRPNOPSA-N |
| XLogP | 4.21 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|