C16H24N2O2 — CID 103600878
ethyl 2-(4-methyl-1,4-diazepan-1-yl)-2-phenylacetate (PubChem CID 103600878) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 2-(4-methyl-1,4-diazepan-1-yl)-2-phenylacetate.
| Compound Name | ethyl 2-(4-methyl-1,4-diazepan-1-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 103600878 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 2-(4-methyl-1,4-diazepan-1-yl)-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1CCCN(C)CC1 |
| InChI | InChI=1S/C16H24N2O2/c1-3-20-16(19)15(14-8-5-4-6-9-14)18-11-7-10-17(2)12-13-18/h4-6,8-9,15H,3,7,10-13H2,1-2H3 |
| InChIKey | PPMZRXQAKXAPBM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |