C23H27NO5 — CID 135312522
ethyl 2-(4-oxopiperidin-1-yl)-2-phenylacetate;2-phenylacetic acid (PubChem CID 135312522) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is ethyl 2-(4-oxopiperidin-1-yl)-2-phenylacetate;2-phenylacetic acid.
| Compound Name | ethyl 2-(4-oxopiperidin-1-yl)-2-phenylacetate;2-phenylacetic acid |
|---|---|
| PubChem CID | 135312522 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | ethyl 2-(4-oxopiperidin-1-yl)-2-phenylacetate;2-phenylacetic acid |
| SMILES | CCOC(=O)C(c1ccccc1)N1CCC(=O)CC1.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO3.C8H8O2/c1-2-19-15(18)14(12-6-4-3-5-7-12)16-10-8-13(17)9-11-16;9-8(10)6-7-4-2-1-3-5-7/h3-7,14H,2,8-11H2,1H3;1-5H,6H2,(H,9,10) |
| InChIKey | DXBJOLJFGGEZDC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |