C27H30N2O2 — CID 121454645
ethyl 2-(4-benzylpiperazin-1-yl)-2-(4-phenylphenyl)acetate (PubChem CID 121454645) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is ethyl 2-(4-benzylpiperazin-1-yl)-2-(4-phenylphenyl)acetate.
| Compound Name | ethyl 2-(4-benzylpiperazin-1-yl)-2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 121454645 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | ethyl 2-(4-benzylpiperazin-1-yl)-2-(4-phenylphenyl)acetate |
| SMILES | CCOC(=O)C(c1ccc(-c2ccccc2)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N2O2/c1-2-31-27(30)26(25-15-13-24(14-16-25)23-11-7-4-8-12-23)29-19-17-28(18-20-29)21-22-9-5-3-6-10-22/h3-16,26H,2,17-21H2,1H3 |
| InChIKey | OKTAVIVMTQOPJD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |