C20H27F3N2O4 — CID 10862623
diethyl 2-[1-(4-benzylpiperazin-1-yl)-2,2,2-trifluoroethyl]propanedioate (PubChem CID 10862623) has the molecular formula C20H27F3N2O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is diethyl 2-[1-(4-benzylpiperazin-1-yl)-2,2,2-trifluoroethyl]propanedioate.
| Compound Name | diethyl 2-[1-(4-benzylpiperazin-1-yl)-2,2,2-trifluoroethyl]propanedioate |
|---|---|
| PubChem CID | 10862623 |
| Molecular Formula | C20H27F3N2O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | diethyl 2-[1-(4-benzylpiperazin-1-yl)-2,2,2-trifluoroethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(N1CCN(Cc2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H27F3N2O4/c1-3-28-18(26)16(19(27)29-4-2)17(20(21,22)23)25-12-10-24(11-13-25)14-15-8-6-5-7-9-15/h5-9,16-17H,3-4,10-14H2,1-2H3 |
| InChIKey | DLDDPRMXCFTJDJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|