C26H28N2O2 — CID 12505294
2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanone (PubChem CID 12505294) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanone.
| Compound Name | 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 12505294 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanone |
| SMILES | COc1ccc(CN2CCN(C(C(=O)c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-30-24-14-12-21(13-15-24)20-27-16-18-28(19-17-27)25(22-8-4-2-5-9-22)26(29)23-10-6-3-7-11-23/h2-15,25H,16-20H2,1H3 |
| InChIKey | RUZDVXJTKJQTNZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |