C26H27ClN2O2 — CID 12505299
1-(4-chlorophenyl)-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenylethanone (PubChem CID 12505299) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 12505299 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenylethanone |
| SMILES | COc1ccc(CN2CCN(C(C(=O)c3ccc(Cl)cc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H27ClN2O2/c1-31-24-13-7-20(8-14-24)19-28-15-17-29(18-16-28)25(21-5-3-2-4-6-21)26(30)22-9-11-23(27)12-10-22/h2-14,25H,15-19H2,1H3 |
| InChIKey | GRQZNBZMIUFSNZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |