C35H43N9O4 — CID 144755125
2-(3-aminobutan-2-yl)-4-[4-[4-[4-[[(4R)-2-phenyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;2-methyltriazole (PubChem CID 144755125) has the molecular formula C35H43N9O4 and a molecular weight of 653.79 g/mol. Its IUPAC name is 2-(3-aminobutan-2-yl)-4-[4-[4-[4-[[(4R)-2-phenyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;2-methyltriazole.
| Compound Name | 2-(3-aminobutan-2-yl)-4-[4-[4-[4-[[(4R)-2-phenyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;2-methyltriazole |
|---|---|
| PubChem CID | 144755125 |
| Molecular Formula | C35H43N9O4 |
| Molecular Weight | 653.79 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | 2-(3-aminobutan-2-yl)-4-[4-[4-[4-[[(4R)-2-phenyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one;2-methyltriazole |
| SMILES | CC(N)C(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5COC(c6ccccc6)O5)cc4)CC3)cc2)c1=O.Cn1nccn1 |
| InChI | InChI=1S/C32H38N6O4.C3H5N3/c1-23(33)24(2)38-32(39)37(22-34-38)28-10-8-26(9-11-28)35-16-18-36(19-17-35)27-12-14-29(15-13-27)40-20-30-21-41-31(42-30)25-6-4-3-5-7-25;1-6-4-2-3-5-6/h3-15,22-24,30-31H,16-21,33H2,1-2H3;2-3H,1H3/t23?,24?,30-,31?;/m1./s1 |
| InChIKey | NDIAPBLUOPAACS-OGHGIDSYSA-N |
| XLogP | 3.58 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|