C31H36N6O4 — CID 129168255
2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyridin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 129168255) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyridin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyridin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129168255 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyridin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@H](c6ccccn6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C31H36N6O4/c1-3-23(2)37-31(38)36(22-33-37)26-9-7-24(8-10-26)34-16-18-35(19-17-34)25-11-13-27(14-12-25)39-20-28-21-40-30(41-28)29-6-4-5-15-32-29/h4-15,22-23,28,30H,3,16-21H2,1-2H3/t23?,28-,30-/m1/s1 |
| InChIKey | ZNBAEGUKTYANAL-BBLJKCSBSA-N |
| XLogP | 4.22 |
| TPSA | 86.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|