C33H37Cl2N5O5 — CID 129168296
2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]-2-methoxyphenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 129168296) has the molecular formula C33H37Cl2N5O5 and a molecular weight of 654.60 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]-2-methoxyphenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]-2-methoxyphenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129168296 |
| Molecular Formula | C33H37Cl2N5O5 |
| Molecular Weight | 654.60 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]-2-methoxyphenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@H](c6ccc(Cl)cc6Cl)O5)cc4OC)CC3)cc2)c1=O |
| InChI | InChI=1S/C33H37Cl2N5O5/c1-4-22(2)40-33(41)39(21-36-40)25-8-6-24(7-9-25)37-13-15-38(16-14-37)30-12-10-26(18-31(30)42-3)43-19-27-20-44-32(45-27)28-11-5-23(34)17-29(28)35/h5-12,17-18,21-22,27,32H,4,13-16,19-20H2,1-3H3/t22?,27-,32-/m1/s1 |
| InChIKey | YMNWGACKSHSNNP-IKNNKXHTSA-N |
| XLogP | 6.14 |
| TPSA | 83.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|