C24H31N5O5S — CID 57318552
[(2S,3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] methanesulfonate (PubChem CID 57318552) has the molecular formula C24H31N5O5S and a molecular weight of 501.61 g/mol. Its IUPAC name is [(2S,3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] methanesulfonate.
| Compound Name | [(2S,3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 57318552 |
| Molecular Formula | C24H31N5O5S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [(2S,3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] methanesulfonate |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4cnn([C@@H](C)[C@H](C)OS(C)(=O)=O)c4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N5O5S/c1-18(19(2)34-35(4,31)32)29-24(30)28(17-25-29)22-7-5-20(6-8-22)26-13-15-27(16-14-26)21-9-11-23(33-3)12-10-21/h5-12,17-19H,13-16H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | ZTTHNOSVJVJKCU-OALUTQOASA-N |
| XLogP | 2.29 |
| TPSA | 98.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|