C22H27N5O3S — CID 143249504
4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-(2-methylsulfanyloxyethyl)-1,2,4-triazol-3-one (PubChem CID 143249504) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-(2-methylsulfanyloxyethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-(2-methylsulfanyloxyethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 143249504 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-(2-methylsulfanyloxyethyl)-1,2,4-triazol-3-one |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4cnn(CCOSC)c4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N5O3S/c1-29-21-9-7-19(8-10-21)25-13-11-24(12-14-25)18-3-5-20(6-4-18)26-17-23-27(22(26)28)15-16-30-31-2/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | JDVVVZLHXOKOON-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|