C20H23N5OS — CID 12877034
1-(4-methoxyphenyl)-4-[4-(3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine (PubChem CID 12877034) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[4-(3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[4-(3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 12877034 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[4-(3-methylsulfanyl-1,2,4-triazol-1-yl)phenyl]piperazine |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4cnc(SC)n4)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23N5OS/c1-26-19-9-7-17(8-10-19)24-13-11-23(12-14-24)16-3-5-18(6-4-16)25-15-21-20(22-25)27-2/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | UOGKADAQQLXRRG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|