C22H31N5OS — CID 45246704
5-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine (PubChem CID 45246704) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 5-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine.
| Compound Name | 5-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 45246704 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 5-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine |
| SMILES | COc1ccc(N2CCN(C3CCCN(Cc4cnc(SC)nc4)C3)CC2)cc1 |
| InChI | InChI=1S/C22H31N5OS/c1-28-21-7-5-19(6-8-21)26-10-12-27(13-11-26)20-4-3-9-25(17-20)16-18-14-23-22(29-2)24-15-18/h5-8,14-15,20H,3-4,9-13,16-17H2,1-2H3 |
| InChIKey | YSWUDPQMVBVRPG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|