C25H33N3O3 — CID 45236118
1-[1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine (PubChem CID 45236118) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 45236118 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(C3CCCN(Cc4ccc5c(c4)OCCO5)C3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O3/c1-29-23-7-5-21(6-8-23)27-11-13-28(14-12-27)22-3-2-10-26(19-22)18-20-4-9-24-25(17-20)31-16-15-30-24/h4-9,17,22H,2-3,10-16,18-19H2,1H3 |
| InChIKey | WMEHIIXJQOAAJL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|