C22H30N4O — CID 30674071
1-(4-methoxyphenyl)-4-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]piperazine (PubChem CID 30674071) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 30674071 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(3R)-1-(pyridin-2-ylmethyl)piperidin-3-yl]piperazine |
| SMILES | COc1ccc(N2CCN([C@@H]3CCCN(Cc4ccccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O/c1-27-22-9-7-20(8-10-22)25-13-15-26(16-14-25)21-6-4-12-24(18-21)17-19-5-2-3-11-23-19/h2-3,5,7-11,21H,4,6,12-18H2,1H3/t21-/m1/s1 |
| InChIKey | SCHYUYOMXOUPND-OAQYLSRUSA-N |
| XLogP | 2.88 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|