C25H35N3O3 — CID 28824109
1-[(3R)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-3-yl]-4-(4-methoxyphenyl)piperazine (PubChem CID 28824109) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[(3R)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-3-yl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(3R)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-3-yl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 28824109 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 1-[(3R)-1-[(3,5-dimethoxyphenyl)methyl]piperidin-3-yl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN([C@@H]3CCCN(Cc4cc(OC)cc(OC)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-29-23-8-6-21(7-9-23)27-11-13-28(14-12-27)22-5-4-10-26(19-22)18-20-15-24(30-2)17-25(16-20)31-3/h6-9,15-17,22H,4-5,10-14,18-19H2,1-3H3/t22-/m1/s1 |
| InChIKey | YUOHWRYUYUIOBJ-JOCHJYFZSA-N |
| XLogP | 3.50 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|