C24H31N3O3 — CID 30723452
1-[(3S)-1-(1,3-benzodioxol-4-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine (PubChem CID 30723452) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[(3S)-1-(1,3-benzodioxol-4-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(3S)-1-(1,3-benzodioxol-4-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 30723452 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[(3S)-1-(1,3-benzodioxol-4-ylmethyl)piperidin-3-yl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN([C@H]3CCCN(Cc4cccc5c4OCO5)C3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-28-22-9-7-20(8-10-22)26-12-14-27(15-13-26)21-5-3-11-25(17-21)16-19-4-2-6-23-24(19)30-18-29-23/h2,4,6-10,21H,3,5,11-18H2,1H3/t21-/m0/s1 |
| InChIKey | IJIFAXXQYQJBAN-NRFANRHFSA-N |
| XLogP | 3.21 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|