C21H35N3O2 — CID 29028751
3-[(3S)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2,2-dimethylpropan-1-ol (PubChem CID 29028751) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-[(3S)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[(3S)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 29028751 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 3-[(3S)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2,2-dimethylpropan-1-ol |
| SMILES | COc1ccc(N2CCN([C@H]3CCCN(CC(C)(C)CO)C3)CC2)cc1 |
| InChI | InChI=1S/C21H35N3O2/c1-21(2,17-25)16-22-10-4-5-19(15-22)24-13-11-23(12-14-24)18-6-8-20(26-3)9-7-18/h6-9,19,25H,4-5,10-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | CMELNRRWBCRIOC-IBGZPJMESA-N |
| XLogP | 2.30 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|