C22H35N3O — CID 56905190
1-(4-methoxyphenyl)-4-[1-(4-methylpent-3-enyl)piperidin-3-yl]piperazine (PubChem CID 56905190) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[1-(4-methylpent-3-enyl)piperidin-3-yl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[1-(4-methylpent-3-enyl)piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 56905190 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[1-(4-methylpent-3-enyl)piperidin-3-yl]piperazine |
| SMILES | COc1ccc(N2CCN(C3CCCN(CCC=C(C)C)C3)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O/c1-19(2)6-4-12-23-13-5-7-21(18-23)25-16-14-24(15-17-25)20-8-10-22(26-3)11-9-20/h6,8-11,21H,4-5,7,12-18H2,1-3H3 |
| InChIKey | YPOPDSHBZXRDAF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|