C19H20ClN5O — CID 58732894
4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-methyl-1,2,4-triazol-3-one (PubChem CID 58732894) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is 4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-methyl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 58732894 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1ncn(-c2ccc(N3CCN(c4ccc(Cl)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C19H20ClN5O/c1-22-19(26)25(14-21-22)18-8-6-17(7-9-18)24-12-10-23(11-13-24)16-4-2-15(20)3-5-16/h2-9,14H,10-13H2,1H3 |
| InChIKey | XDPLRAIWMFNXIU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|