C23H29N5O6S — CID 169437207
[1,1,1,2,3,4,4,4-octadeuterio-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] hydrogen sulfate (PubChem CID 169437207) has the molecular formula C23H29N5O6S and a molecular weight of 511.63 g/mol. Its IUPAC name is [1,1,1,2,3,4,4,4-octadeuterio-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] hydrogen sulfate.
| Compound Name | [1,1,1,2,3,4,4,4-octadeuterio-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 169437207 |
| Molecular Formula | C23H29N5O6S |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | [1,1,1,2,3,4,4,4-octadeuterio-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] hydrogen sulfate |
| SMILES | [2H]C([2H])([2H])C([2H])(OS(=O)(=O)O)C([2H])(n1ncn(-c2ccc(N3CCN(c4ccc(OC)cc4)CC3)cc2)c1=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C23H29N5O6S/c1-17(18(2)34-35(30,31)32)28-23(29)27(16-24-28)21-6-4-19(5-7-21)25-12-14-26(15-13-25)20-8-10-22(33-3)11-9-20/h4-11,16-18H,12-15H2,1-3H3,(H,30,31,32)/i1D3,2D3,17D,18D |
| InChIKey | CUMSICLMMAXPEO-QTDKDROASA-N |
| XLogP | 2.14 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|