C30H33N5O4 — CID 59910893
[(3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] benzoate (PubChem CID 59910893) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is [(3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] benzoate.
| Compound Name | [(3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] benzoate |
|---|---|
| PubChem CID | 59910893 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | [(3S)-3-[4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]butan-2-yl] benzoate |
| SMILES | COc1ccc(N2CCN(c3ccc(-n4cnn([C@@H](C)C(C)OC(=O)c5ccccc5)c4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H33N5O4/c1-22(23(2)39-29(36)24-7-5-4-6-8-24)35-30(37)34(21-31-35)27-11-9-25(10-12-27)32-17-19-33(20-18-32)26-13-15-28(38-3)16-14-26/h4-16,21-23H,17-20H2,1-3H3/t22-,23?/m0/s1 |
| InChIKey | NBYQGMDRGPGFJU-NQCNTLBGSA-N |
| XLogP | 4.18 |
| TPSA | 81.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|