C35H37F2N11O4 — CID 86758051
2-(3-azidobutan-2-yl)-4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 86758051) has the molecular formula C35H37F2N11O4 and a molecular weight of 713.75 g/mol. Its IUPAC name is 2-(3-azidobutan-2-yl)-4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-(3-azidobutan-2-yl)-4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 86758051 |
| Molecular Formula | C35H37F2N11O4 |
| Molecular Weight | 713.75 g/mol |
| Exact Mass | 713.30 |
| IUPAC Name | 2-(3-azidobutan-2-yl)-4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CC(N=[N+]=[N-])C(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(F)cc6F)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C35H37F2N11O4/c1-24(42-43-38)25(2)48-34(49)47(23-41-48)29-6-4-27(5-7-29)44-13-15-45(16-14-44)28-8-10-30(11-9-28)50-18-31-19-51-35(52-31,20-46-22-39-21-40-46)32-12-3-26(36)17-33(32)37/h3-12,17,21-25,31H,13-16,18-20H2,1-2H3 |
| InChIKey | ITCIPSSBKRFKFY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 153.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|