C36H39F2N7O4 — CID 19980376
1-butan-2-yl-3-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazol-2-one (PubChem CID 19980376) has the molecular formula C36H39F2N7O4 and a molecular weight of 671.75 g/mol. Its IUPAC name is 1-butan-2-yl-3-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazol-2-one.
| Compound Name | 1-butan-2-yl-3-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 19980376 |
| Molecular Formula | C36H39F2N7O4 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | 1-butan-2-yl-3-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazol-2-one |
| SMILES | CCC(C)n1ccn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(F)cc6F)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C36H39F2N7O4/c1-3-26(2)44-18-19-45(35(44)46)30-7-5-28(6-8-30)41-14-16-42(17-15-41)29-9-11-31(12-10-29)47-21-32-22-48-36(49-32,23-43-25-39-24-40-43)33-13-4-27(37)20-34(33)38/h4-13,18-20,24-26,32H,3,14-17,21-23H2,1-2H3 |
| InChIKey | BWCVCVKNOKWXFU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|