C36H40F2N8O5 — CID 14350015
4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one (PubChem CID 14350015) has the molecular formula C36H40F2N8O5 and a molecular weight of 702.76 g/mol. Its IUPAC name is 4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 14350015 |
| Molecular Formula | C36H40F2N8O5 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | 4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(2-propoxyethyl)-1,2,4-triazol-3-one |
| SMILES | CCCOCCn1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(F)cc6F)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C36H40F2N8O5/c1-2-18-48-19-17-46-35(47)45(26-41-46)30-6-4-28(5-7-30)42-13-15-43(16-14-42)29-8-10-31(11-9-29)49-21-32-22-50-36(51-32,23-44-25-39-24-40-44)33-12-3-27(37)20-34(33)38/h3-12,20,24-26,32H,2,13-19,21-23H2,1H3 |
| InChIKey | GXEACAJBKNXHFS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|