C32H39N9O3 — CID 145098663
2-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]benzonitrile (PubChem CID 145098663) has the molecular formula C32H39N9O3 and a molecular weight of 597.72 g/mol. Its IUPAC name is 2-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]benzonitrile.
| Compound Name | 2-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 145098663 |
| Molecular Formula | C32H39N9O3 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | 2-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[5-(triazol-2-ylmethyl)oxolan-3-yl]methoxy]benzonitrile |
| SMILES | CCC(CC)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6nccn6)C5)cc4C#N)CC3)cc2)c1=O |
| InChI | InChI=1S/C32H39N9O3/c1-3-26(4-2)41-32(42)39(23-36-41)28-7-5-27(6-8-28)37-13-15-38(16-14-37)31-10-9-29(18-25(31)19-33)43-21-24-17-30(44-22-24)20-40-34-11-12-35-40/h5-12,18,23-24,26,30H,3-4,13-17,20-22H2,1-2H3 |
| InChIKey | FVQSHRMCWCSIQD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 119.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|