C36H45FN8O3 — CID 145098582
benzene;2-butan-2-yl-4-[4-[4-[4-[[5-(1,5-dihydrotriazol-2-ylmethyl)oxolan-3-yl]methoxy]-2-fluorophenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 145098582) has the molecular formula C36H45FN8O3 and a molecular weight of 656.81 g/mol. Its IUPAC name is benzene;2-butan-2-yl-4-[4-[4-[4-[[5-(1,5-dihydrotriazol-2-ylmethyl)oxolan-3-yl]methoxy]-2-fluorophenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | benzene;2-butan-2-yl-4-[4-[4-[4-[[5-(1,5-dihydrotriazol-2-ylmethyl)oxolan-3-yl]methoxy]-2-fluorophenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 145098582 |
| Molecular Formula | C36H45FN8O3 |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | benzene;2-butan-2-yl-4-[4-[4-[4-[[5-(1,5-dihydrotriazol-2-ylmethyl)oxolan-3-yl]methoxy]-2-fluorophenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(CN6N=CCN6)C5)cc4F)CC3)cc2)c1=O.c1ccccc1 |
| InChI | InChI=1S/C30H39FN8O3.C6H6/c1-3-22(2)39-30(40)37(21-34-39)25-6-4-24(5-7-25)35-12-14-36(15-13-35)29-9-8-26(17-28(29)31)41-19-23-16-27(42-20-23)18-38-32-10-11-33-38;1-2-4-6-5-3-1/h4-10,17,21-23,27,33H,3,11-16,18-20H2,1-2H3;1-6H |
| InChIKey | LCLQKCFCMDDRKG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|