C23H20Cl2O — CID 42603793
(2R,6S)-2,6-bis(2-chlorophenyl)-4-phenyloxane (PubChem CID 42603793) has the molecular formula C23H20Cl2O and a molecular weight of 383.32 g/mol. Its IUPAC name is (2R,6S)-2,6-bis(2-chlorophenyl)-4-phenyloxane.
| Compound Name | (2R,6S)-2,6-bis(2-chlorophenyl)-4-phenyloxane |
|---|---|
| PubChem CID | 42603793 |
| Molecular Formula | C23H20Cl2O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (2R,6S)-2,6-bis(2-chlorophenyl)-4-phenyloxane |
| SMILES | Clc1ccccc1[C@@H]1CC(c2ccccc2)C[C@H](c2ccccc2Cl)O1 |
| InChI | InChI=1S/C23H20Cl2O/c24-20-12-6-4-10-18(20)22-14-17(16-8-2-1-3-9-16)15-23(26-22)19-11-5-7-13-21(19)25/h1-13,17,22-23H,14-15H2/t17?,22-,23+ |
| InChIKey | NSIKZUJJXKWBFB-FKWVHYFSSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |