C18H14 — CID 4118963
15,16-dimethylidenetetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 4118963) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 15,16-dimethylidenetetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 15,16-dimethylidenetetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 4118963 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 15,16-dimethylidenetetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | C=C1C(=C)C2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C18H14/c1-11-12(2)18-15-9-5-3-7-13(15)17(11)14-8-4-6-10-16(14)18/h3-10,17-18H,1-2H2 |
| InChIKey | ADTSKKGHPHDXSC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |