C9H10N2O2 — CID 86031829
3,4-diamino-3,4-dihydrochromen-2-one (PubChem CID 86031829) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3,4-diamino-3,4-dihydrochromen-2-one.
| Compound Name | 3,4-diamino-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 86031829 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3,4-diamino-3,4-dihydrochromen-2-one |
| SMILES | NC1C(=O)Oc2ccccc2C1N |
| InChI | InChI=1S/C9H10N2O2/c10-7-5-3-1-2-4-6(5)13-9(12)8(7)11/h1-4,7-8H,10-11H2 |
| InChIKey | QMTOOPCWCXSTQX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|