About 3-methyl-3H-1-benzofuran-2-one;oxalonitrile
3-methyl-3H-1-benzofuran-2-one;oxalonitrile (PubChem CID 174570179) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-methyl-3H-1-benzofuran-2-one;oxalonitrile.
Molecular Properties
| Compound Name | 3-methyl-3H-1-benzofuran-2-one;oxalonitrile |
| PubChem CID | 174570179 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-methyl-3H-1-benzofuran-2-one;oxalonitrile |
| SMILES | CC1C(=O)Oc2ccccc21.N#CC#N |
| InChI | InChI=1S/C9H8O2.C2N2/c1-6-7-4-2-3-5-8(7)11-9(6)10;3-1-2-4/h2-6H,1H3; |
| InChIKey | IZLQQTYTTPUAGD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3H-1-benzofuran-2-one;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3H-1-benzofuran-2-one;oxalonitrile?
The IUPAC name of 3-methyl-3H-1-benzofuran-2-one;oxalonitrile (CID 174570179) is 3-methyl-3H-1-benzofuran-2-one;oxalonitrile.
What is the SMILES notation for 3-methyl-3H-1-benzofuran-2-one;oxalonitrile?
The canonical SMILES for 3-methyl-3H-1-benzofuran-2-one;oxalonitrile is CC1C(=O)Oc2ccccc21.N#CC#N.
What is the InChIKey of 3-methyl-3H-1-benzofuran-2-one;oxalonitrile?
The InChIKey is IZLQQTYTTPUAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C2N2/c1-6-7-4-2-3-5-8(7)11-9(6)10;3-1-2-4/h2-6H,1H3;.
What are the key properties of 3-methyl-3H-1-benzofuran-2-one;oxalonitrile?
3-methyl-3H-1-benzofuran-2-one;oxalonitrile has a molecular weight of 200.20 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3H-1-benzofuran-2-one;oxalonitrile is sourced from PubChem (CID 174570179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).