About 9-methyl-9H-xanthene;propane
9-methyl-9H-xanthene;propane (PubChem CID 143256907) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 9-methyl-9H-xanthene;propane.
Molecular Properties
| Compound Name | 9-methyl-9H-xanthene;propane |
| PubChem CID | 143256907 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 9-methyl-9H-xanthene;propane |
| SMILES | CC1c2ccccc2Oc2ccccc21.CCC |
| InChI | InChI=1S/C14H12O.C3H8/c1-10-11-6-2-4-8-13(11)15-14-9-5-3-7-12(10)14;1-3-2/h2-10H,1H3;3H2,1-2H3 |
| InChIKey | SZDHCDNCWSZANT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-methyl-9H-xanthene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-9H-xanthene;propane?
The IUPAC name of 9-methyl-9H-xanthene;propane (CID 143256907) is 9-methyl-9H-xanthene;propane.
What is the SMILES notation for 9-methyl-9H-xanthene;propane?
The canonical SMILES for 9-methyl-9H-xanthene;propane is CC1c2ccccc2Oc2ccccc21.CCC.
What is the InChIKey of 9-methyl-9H-xanthene;propane?
The InChIKey is SZDHCDNCWSZANT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C3H8/c1-10-11-6-2-4-8-13(11)15-14-9-5-3-7-12(10)14;1-3-2/h2-10H,1H3;3H2,1-2H3.
What are the key properties of 9-methyl-9H-xanthene;propane?
9-methyl-9H-xanthene;propane has a molecular weight of 240.35 g/mol, XLogP of 5.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-9H-xanthene;propane is sourced from PubChem (CID 143256907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).