C17H24O2 — CID 131978924
3,4-ditert-butyl-3,4-dihydrochromen-2-one (PubChem CID 131978924) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,4-ditert-butyl-3,4-dihydrochromen-2-one.
| Compound Name | 3,4-ditert-butyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 131978924 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3,4-ditert-butyl-3,4-dihydrochromen-2-one |
| SMILES | CC(C)(C)C1C(=O)Oc2ccccc2C1C(C)(C)C |
| InChI | InChI=1S/C17H24O2/c1-16(2,3)13-11-9-7-8-10-12(11)19-15(18)14(13)17(4,5)6/h7-10,13-14H,1-6H3 |
| InChIKey | PBKYPIIHLWPZNF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|