C17H13FO2 — CID 11357655
(4R,5S)-5-(4-fluorophenyl)-3-methylidene-4-phenyloxolan-2-one (PubChem CID 11357655) has the molecular formula C17H13FO2 and a molecular weight of 268.29 g/mol. Its IUPAC name is (4R,5S)-5-(4-fluorophenyl)-3-methylidene-4-phenyloxolan-2-one.
| Compound Name | (4R,5S)-5-(4-fluorophenyl)-3-methylidene-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 11357655 |
| Molecular Formula | C17H13FO2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (4R,5S)-5-(4-fluorophenyl)-3-methylidene-4-phenyloxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](c2ccc(F)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H13FO2/c1-11-15(12-5-3-2-4-6-12)16(20-17(11)19)13-7-9-14(18)10-8-13/h2-10,15-16H,1H2/t15-,16+/m0/s1 |
| InChIKey | BYMKBWBLVUKELB-JKSUJKDBSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|