C17H12F2O2 — CID 122369438
(4R,5S)-5-(3,4-difluorophenyl)-3-methylidene-4-phenyloxolan-2-one (PubChem CID 122369438) has the molecular formula C17H12F2O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is (4R,5S)-5-(3,4-difluorophenyl)-3-methylidene-4-phenyloxolan-2-one.
| Compound Name | (4R,5S)-5-(3,4-difluorophenyl)-3-methylidene-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 122369438 |
| Molecular Formula | C17H12F2O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (4R,5S)-5-(3,4-difluorophenyl)-3-methylidene-4-phenyloxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](c2ccc(F)c(F)c2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H12F2O2/c1-10-15(11-5-3-2-4-6-11)16(21-17(10)20)12-7-8-13(18)14(19)9-12/h2-9,15-16H,1H2/t15-,16+/m0/s1 |
| InChIKey | BNTPSTKZCDNPLS-JKSUJKDBSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|