C15H10F2O2 — CID 114517364
6,7-difluoro-3-phenyl-3,4-dihydroisochromen-1-one (PubChem CID 114517364) has the molecular formula C15H10F2O2 and a molecular weight of 260.24 g/mol. Its IUPAC name is 6,7-difluoro-3-phenyl-3,4-dihydroisochromen-1-one.
| Compound Name | 6,7-difluoro-3-phenyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 114517364 |
| Molecular Formula | C15H10F2O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 6,7-difluoro-3-phenyl-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(c2ccccc2)Cc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H10F2O2/c16-12-6-10-7-14(9-4-2-1-3-5-9)19-15(18)11(10)8-13(12)17/h1-6,8,14H,7H2 |
| InChIKey | YRNGTYRUOQELIS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |